C15H18O2S — CID 83173297
2-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane-2-carboxylic acid (PubChem CID 83173297) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane-2-carboxylic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83173297 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane-2-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc3c(c2)CCC3)CCCS1 |
| InChI | InChI=1S/C15H18O2S/c16-14(17)15(7-2-8-18-15)10-11-5-6-12-3-1-4-13(12)9-11/h5-6,9H,1-4,7-8,10H2,(H,16,17) |
| InChIKey | CPFBSPNQNHGYSP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |