C16H22O2S — CID 83173307
2-[(4-tert-butylphenyl)methyl]thiolane-2-carboxylic acid (PubChem CID 83173307) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]thiolane-2-carboxylic acid.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83173307 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]thiolane-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(CC2(C(=O)O)CCCS2)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-15(2,3)13-7-5-12(6-8-13)11-16(14(17)18)9-4-10-19-16/h5-8H,4,9-11H2,1-3H3,(H,17,18) |
| InChIKey | BJRWIPFCCZLCLG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |