C14H18O2S — CID 83174391
2-[(2,6-dimethylphenyl)methyl]thiolane-2-carboxylic acid (PubChem CID 83174391) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)methyl]thiolane-2-carboxylic acid.
| Compound Name | 2-[(2,6-dimethylphenyl)methyl]thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83174391 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)methyl]thiolane-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1CC1(C(=O)O)CCCS1 |
| InChI | InChI=1S/C14H18O2S/c1-10-5-3-6-11(2)12(10)9-14(13(15)16)7-4-8-17-14/h3,5-6H,4,7-9H2,1-2H3,(H,15,16) |
| InChIKey | DMASFAZGMWFRPT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |