C26H32O2S2 — CID 121472067
3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dithiolan-2-yl]phenyl]propanoic acid (PubChem CID 121472067) has the molecular formula C26H32O2S2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dithiolan-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dithiolan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121472067 |
| Molecular Formula | C26H32O2S2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dithiolan-2-yl]phenyl]propanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C3(c4ccc(CCC(=O)O)cc4)SCCS3)ccc21 |
| InChI | InChI=1S/C26H32O2S2/c1-24(2)13-14-25(3,4)22-17-20(10-11-21(22)24)26(29-15-16-30-26)19-8-5-18(6-9-19)7-12-23(27)28/h5-6,8-11,17H,7,12-16H2,1-4H3,(H,27,28) |
| InChIKey | HOUMKQOYHWVXDO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |