C17H25NO2 — CID 19077125
3-(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propanoic acid (PubChem CID 19077125) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propanoic acid.
| Compound Name | 3-(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 19077125 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(CCC(=O)O)c(N)cc21 |
| InChI | InChI=1S/C17H25NO2/c1-16(2)7-8-17(3,4)13-10-14(18)11(9-12(13)16)5-6-15(19)20/h9-10H,5-8,18H2,1-4H3,(H,19,20) |
| InChIKey | HDKIBBZYXULNIA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|