C9H13N3O2S — CID 107057541
2-[(1-methyltriazol-4-yl)methyl]thiolane-2-carboxylic acid (PubChem CID 107057541) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-[(1-methyltriazol-4-yl)methyl]thiolane-2-carboxylic acid.
| Compound Name | 2-[(1-methyltriazol-4-yl)methyl]thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 107057541 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[(1-methyltriazol-4-yl)methyl]thiolane-2-carboxylic acid |
| SMILES | Cn1cc(CC2(C(=O)O)CCCS2)nn1 |
| InChI | InChI=1S/C9H13N3O2S/c1-12-6-7(10-11-12)5-9(8(13)14)3-2-4-15-9/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | XTECDORGKKWLOF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |