C8H12N4O2 — CID 107044966
1-[(1-methyltriazol-4-yl)methylamino]cyclopropane-1-carboxylic acid (PubChem CID 107044966) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-[(1-methyltriazol-4-yl)methylamino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(1-methyltriazol-4-yl)methylamino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 107044966 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-[(1-methyltriazol-4-yl)methylamino]cyclopropane-1-carboxylic acid |
| SMILES | Cn1cc(CNC2(C(=O)O)CC2)nn1 |
| InChI | InChI=1S/C8H12N4O2/c1-12-5-6(10-11-12)4-9-8(2-3-8)7(13)14/h5,9H,2-4H2,1H3,(H,13,14) |
| InChIKey | RJONOTPMOCEOQY-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |