C10H18N4O2 — CID 107045011
2-ethyl-2-[(1-methyltriazol-4-yl)methylamino]butanoic acid (PubChem CID 107045011) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-ethyl-2-[(1-methyltriazol-4-yl)methylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[(1-methyltriazol-4-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 107045011 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-ethyl-2-[(1-methyltriazol-4-yl)methylamino]butanoic acid |
| SMILES | CCC(CC)(NCc1cn(C)nn1)C(=O)O |
| InChI | InChI=1S/C10H18N4O2/c1-4-10(5-2,9(15)16)11-6-8-7-14(3)13-12-8/h7,11H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | DLUCZOVPZIZFNQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |