C15H20O — CID 106798252
1-[1-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropyl]ethanol (PubChem CID 106798252) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropyl]ethanol.
| Compound Name | 1-[1-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 106798252 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-[1-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropyl]ethanol |
| SMILES | CC(O)C1(Cc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C15H20O/c1-11(16)15(7-8-15)10-12-5-6-13-3-2-4-14(13)9-12/h5-6,9,11,16H,2-4,7-8,10H2,1H3 |
| InChIKey | YYPVKPMHSYFGAY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |