C14H18O — CID 83686763
[1-(2,3-dihydro-1H-inden-5-yl)cyclobutyl]methanol (PubChem CID 83686763) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-5-yl)cyclobutyl]methanol.
| Compound Name | [1-(2,3-dihydro-1H-inden-5-yl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 83686763 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-5-yl)cyclobutyl]methanol |
| SMILES | OCC1(c2ccc3c(c2)CCC3)CCC1 |
| InChI | InChI=1S/C14H18O/c15-10-14(7-2-8-14)13-6-5-11-3-1-4-12(11)9-13/h5-6,9,15H,1-4,7-8,10H2 |
| InChIKey | LCOANVLXTACGRU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |