C13H16O2 — CID 116829694
[3-(2,3-dihydro-1H-inden-5-yl)oxetan-3-yl]methanol (PubChem CID 116829694) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-inden-5-yl)oxetan-3-yl]methanol.
| Compound Name | [3-(2,3-dihydro-1H-inden-5-yl)oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116829694 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [3-(2,3-dihydro-1H-inden-5-yl)oxetan-3-yl]methanol |
| SMILES | OCC1(c2ccc3c(c2)CCC3)COC1 |
| InChI | InChI=1S/C13H16O2/c14-7-13(8-15-9-13)12-5-4-10-2-1-3-11(10)6-12/h4-6,14H,1-3,7-9H2 |
| InChIKey | COESKFIQEOLMOE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |