C13H13NO — CID 116873126
3-(2,3-dihydro-1H-inden-5-yl)oxetane-3-carbonitrile (PubChem CID 116873126) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)oxetane-3-carbonitrile.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 116873126 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)oxetane-3-carbonitrile |
| SMILES | N#CC1(c2ccc3c(c2)CCC3)COC1 |
| InChI | InChI=1S/C13H13NO/c14-7-13(8-15-9-13)12-5-4-10-2-1-3-11(10)6-12/h4-6H,1-3,8-9H2 |
| InChIKey | UNVVFTOWOQXCSF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |