C15H16N2O2 — CID 116996965
3-(1,3,3-trimethyl-2-oxoindol-5-yl)oxetane-3-carbonitrile (PubChem CID 116996965) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-(1,3,3-trimethyl-2-oxoindol-5-yl)oxetane-3-carbonitrile.
| Compound Name | 3-(1,3,3-trimethyl-2-oxoindol-5-yl)oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 116996965 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-(1,3,3-trimethyl-2-oxoindol-5-yl)oxetane-3-carbonitrile |
| SMILES | CN1C(=O)C(C)(C)c2cc(C3(C#N)COC3)ccc21 |
| InChI | InChI=1S/C15H16N2O2/c1-14(2)11-6-10(15(7-16)8-19-9-15)4-5-12(11)17(3)13(14)18/h4-6H,8-9H2,1-3H3 |
| InChIKey | DHYQVFMTYHWQMD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |