C17H21NO — CID 116996604
[1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclobutyl]methanol (PubChem CID 116996604) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is [1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclobutyl]methanol.
| Compound Name | [1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 116996604 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | [1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclobutyl]methanol |
| SMILES | OCC1(c2ccc3[nH]c4c(c3c2)CCCC4)CCC1 |
| InChI | InChI=1S/C17H21NO/c19-11-17(8-3-9-17)12-6-7-16-14(10-12)13-4-1-2-5-15(13)18-16/h6-7,10,18-19H,1-5,8-9,11H2 |
| InChIKey | ZAZHJLUEEUBKCA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|