C13H10F4O2 — CID 83175379
1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanol (PubChem CID 83175379) has the molecular formula C13H10F4O2 and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanol.
| Compound Name | 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanol |
|---|---|
| PubChem CID | 83175379 |
| Molecular Formula | C13H10F4O2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanol |
| SMILES | OC(Cc1ccoc1)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H10F4O2/c14-9-1-2-11(13(15,16)17)10(6-9)12(18)5-8-3-4-19-7-8/h1-4,6-7,12,18H,5H2 |
| InChIKey | AMCDFLZTMLDNNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |