C15H17ClFNO — CID 83176143
N-[1-(3-chloro-2-fluorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine (PubChem CID 83176143) has the molecular formula C15H17ClFNO and a molecular weight of 281.76 g/mol. Its IUPAC name is N-[1-(3-chloro-2-fluorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-chloro-2-fluorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 83176143 |
| Molecular Formula | C15H17ClFNO |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[1-(3-chloro-2-fluorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccoc1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C15H17ClFNO/c1-2-7-18-14(9-11-6-8-19-10-11)12-4-3-5-13(16)15(12)17/h3-6,8,10,14,18H,2,7,9H2,1H3 |
| InChIKey | NCOHUKAKRYNORW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |