C9H13NO4 — CID 83176620
5-(4-hydroxybutan-2-ylamino)furan-2-carboxylic acid (PubChem CID 83176620) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(4-hydroxybutan-2-ylamino)furan-2-carboxylic acid.
| Compound Name | 5-(4-hydroxybutan-2-ylamino)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 83176620 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-(4-hydroxybutan-2-ylamino)furan-2-carboxylic acid |
| SMILES | CC(CCO)Nc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C9H13NO4/c1-6(4-5-11)10-8-3-2-7(14-8)9(12)13/h2-3,6,10-11H,4-5H2,1H3,(H,12,13) |
| InChIKey | QGEQADYFFIKUKZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |