C8H10N2O5 — CID 106177280
5-[(3-amino-2-hydroxy-3-oxopropyl)amino]furan-2-carboxylic acid (PubChem CID 106177280) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 5-[(3-amino-2-hydroxy-3-oxopropyl)amino]furan-2-carboxylic acid.
| Compound Name | 5-[(3-amino-2-hydroxy-3-oxopropyl)amino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106177280 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 5-[(3-amino-2-hydroxy-3-oxopropyl)amino]furan-2-carboxylic acid |
| SMILES | NC(=O)C(O)CNc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H10N2O5/c9-7(12)4(11)3-10-6-2-1-5(15-6)8(13)14/h1-2,4,10-11H,3H2,(H2,9,12)(H,13,14) |
| InChIKey | UZFQGMMRNVHSPL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |