C8H8F3NO3 — CID 63228123
5-(3,3,3-trifluoropropylamino)furan-2-carboxylic acid (PubChem CID 63228123) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 5-(3,3,3-trifluoropropylamino)furan-2-carboxylic acid.
| Compound Name | 5-(3,3,3-trifluoropropylamino)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63228123 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 5-(3,3,3-trifluoropropylamino)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCC(F)(F)F)o1 |
| InChI | InChI=1S/C8H8F3NO3/c9-8(10,11)3-4-12-6-2-1-5(15-6)7(13)14/h1-2,12H,3-4H2,(H,13,14) |
| InChIKey | JEOOMEURBQBIHE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |