C11H20N4O — CID 83180272
3-[[2-(propylamino)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 83180272) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-[[2-(propylamino)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 3-[[2-(propylamino)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83180272 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-[[2-(propylamino)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CCCNc1nccc(NC(C)CCO)n1 |
| InChI | InChI=1S/C11H20N4O/c1-3-6-12-11-13-7-4-10(15-11)14-9(2)5-8-16/h4,7,9,16H,3,5-6,8H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | RCQCNQRAOSDHRK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |