C15H17N3O2 — CID 83181251
2-[(2-ethylphenyl)methylamino]-4-methylpyrimidine-5-carboxylic acid (PubChem CID 83181251) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[(2-ethylphenyl)methylamino]-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[(2-ethylphenyl)methylamino]-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 83181251 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-[(2-ethylphenyl)methylamino]-4-methylpyrimidine-5-carboxylic acid |
| SMILES | CCc1ccccc1CNc1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C15H17N3O2/c1-3-11-6-4-5-7-12(11)8-16-15-17-9-13(14(19)20)10(2)18-15/h4-7,9H,3,8H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | RJVOZYJSVCFHEN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |