C15H27NO — CID 83182898
N-tert-butyl-2-(furan-3-ylmethyl)-2-methylpentan-1-amine (PubChem CID 83182898) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-tert-butyl-2-(furan-3-ylmethyl)-2-methylpentan-1-amine.
| Compound Name | N-tert-butyl-2-(furan-3-ylmethyl)-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 83182898 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-tert-butyl-2-(furan-3-ylmethyl)-2-methylpentan-1-amine |
| SMILES | CCCC(C)(CNC(C)(C)C)Cc1ccoc1 |
| InChI | InChI=1S/C15H27NO/c1-6-8-15(5,12-16-14(2,3)4)10-13-7-9-17-11-13/h7,9,11,16H,6,8,10,12H2,1-5H3 |
| InChIKey | FQFSJBXNZGFYQZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |