C13H15ClN4 — CID 83184333
1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 83184333) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 83184333 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-[5-(chloromethyl)-4-methylpyrimidin-2-yl]-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | Cc1nc(-n2cnc3c2CCCC3)ncc1CCl |
| InChI | InChI=1S/C13H15ClN4/c1-9-10(6-14)7-15-13(17-9)18-8-16-11-4-2-3-5-12(11)18/h7-8H,2-6H2,1H3 |
| InChIKey | OEJDJBRXIWUWOB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|