C8H13ClN2S — CID 83186501
4-chloro-N-(1,3-thiazol-2-ylmethyl)butan-2-amine (PubChem CID 83186501) has the molecular formula C8H13ClN2S and a molecular weight of 204.73 g/mol. Its IUPAC name is 4-chloro-N-(1,3-thiazol-2-ylmethyl)butan-2-amine.
| Compound Name | 4-chloro-N-(1,3-thiazol-2-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 83186501 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-chloro-N-(1,3-thiazol-2-ylmethyl)butan-2-amine |
| SMILES | CC(CCCl)NCc1nccs1 |
| InChI | InChI=1S/C8H13ClN2S/c1-7(2-3-9)11-6-8-10-4-5-12-8/h4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | AXQBWBFANOBUIC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|