C14H20ClN5 — CID 83189101
N-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-methylpyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 83189101) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is N-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-methylpyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 83189101 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(-n2nc(C)c(Cl)c2C)nc1C |
| InChI | InChI=1S/C14H20ClN5/c1-5-6-16-7-12-8-17-14(18-9(12)2)20-11(4)13(15)10(3)19-20/h8,16H,5-7H2,1-4H3 |
| InChIKey | WQFHADJGNOELEW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|