C12H14BrClOS — CID 83190412
3-bromo-4-[(5-chloro-2-methoxyphenyl)methyl]thiolane (PubChem CID 83190412) has the molecular formula C12H14BrClOS and a molecular weight of 321.67 g/mol. Its IUPAC name is 3-bromo-4-[(5-chloro-2-methoxyphenyl)methyl]thiolane.
| Compound Name | 3-bromo-4-[(5-chloro-2-methoxyphenyl)methyl]thiolane |
|---|---|
| PubChem CID | 83190412 |
| Molecular Formula | C12H14BrClOS |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 3-bromo-4-[(5-chloro-2-methoxyphenyl)methyl]thiolane |
| SMILES | COc1ccc(Cl)cc1CC1CSCC1Br |
| InChI | InChI=1S/C12H14BrClOS/c1-15-12-3-2-10(14)5-8(12)4-9-6-16-7-11(9)13/h2-3,5,9,11H,4,6-7H2,1H3 |
| InChIKey | KVFAOGCWGLQQQQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|