C12H18Br2N2S — CID 83190531
4-bromo-5-[(4-bromothiolan-3-yl)methyl]-1,3-diethylpyrazole (PubChem CID 83190531) has the molecular formula C12H18Br2N2S and a molecular weight of 382.17 g/mol. Its IUPAC name is 4-bromo-5-[(4-bromothiolan-3-yl)methyl]-1,3-diethylpyrazole.
| Compound Name | 4-bromo-5-[(4-bromothiolan-3-yl)methyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 83190531 |
| Molecular Formula | C12H18Br2N2S |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 4-bromo-5-[(4-bromothiolan-3-yl)methyl]-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(CC2CSCC2Br)c1Br |
| InChI | InChI=1S/C12H18Br2N2S/c1-3-10-12(14)11(16(4-2)15-10)5-8-6-17-7-9(8)13/h8-9H,3-7H2,1-2H3 |
| InChIKey | MIKJMTAAGZNIMP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|