About 3-chloro-4-octylthiolane
3-chloro-4-octylthiolane (PubChem CID 83191147) has the molecular formula C12H23ClS
and a molecular weight of 234.84 g/mol. Its IUPAC name is 3-chloro-4-octylthiolane.
Molecular Properties
| Compound Name | 3-chloro-4-octylthiolane |
| PubChem CID | 83191147 |
| Molecular Formula | C12H23ClS |
| Molecular Weight | 234.84 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-chloro-4-octylthiolane |
| SMILES | CCCCCCCCC1CSCC1Cl |
| InChI | InChI=1S/C12H23ClS/c1-2-3-4-5-6-7-8-11-9-14-10-12(11)13/h11-12H,2-10H2,1H3 |
| InChIKey | FKABMCNPTWXNKO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-octylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-octylthiolane?
The IUPAC name of 3-chloro-4-octylthiolane (CID 83191147) is 3-chloro-4-octylthiolane.
What is the SMILES notation for 3-chloro-4-octylthiolane?
The canonical SMILES for 3-chloro-4-octylthiolane is CCCCCCCCC1CSCC1Cl.
What is the InChIKey of 3-chloro-4-octylthiolane?
The InChIKey is FKABMCNPTWXNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23ClS/c1-2-3-4-5-6-7-8-11-9-14-10-12(11)13/h11-12H,2-10H2,1H3.
What are the key properties of 3-chloro-4-octylthiolane?
3-chloro-4-octylthiolane has a molecular weight of 234.84 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-octylthiolane is sourced from PubChem (CID 83191147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).