About 4-nonylthiolan-3-amine
4-nonylthiolan-3-amine (PubChem CID 83196598) has the molecular formula C13H27NS
and a molecular weight of 229.43 g/mol. Its IUPAC name is 4-nonylthiolan-3-amine.
Molecular Properties
| Compound Name | 4-nonylthiolan-3-amine |
| PubChem CID | 83196598 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 4-nonylthiolan-3-amine |
| SMILES | CCCCCCCCCC1CSCC1N |
| InChI | InChI=1S/C13H27NS/c1-2-3-4-5-6-7-8-9-12-10-15-11-13(12)14/h12-13H,2-11,14H2,1H3 |
| InChIKey | WXXZSEYCTODOKS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nonylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonylthiolan-3-amine?
The IUPAC name of 4-nonylthiolan-3-amine (CID 83196598) is 4-nonylthiolan-3-amine.
What is the SMILES notation for 4-nonylthiolan-3-amine?
The canonical SMILES for 4-nonylthiolan-3-amine is CCCCCCCCCC1CSCC1N.
What is the InChIKey of 4-nonylthiolan-3-amine?
The InChIKey is WXXZSEYCTODOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NS/c1-2-3-4-5-6-7-8-9-12-10-15-11-13(12)14/h12-13H,2-11,14H2,1H3.
What are the key properties of 4-nonylthiolan-3-amine?
4-nonylthiolan-3-amine has a molecular weight of 229.43 g/mol, XLogP of 3.82, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonylthiolan-3-amine is sourced from PubChem (CID 83196598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).