About 4-butylthian-3-amine
4-butylthian-3-amine (PubChem CID 84766556) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is 4-butylthian-3-amine.
Molecular Properties
| Compound Name | 4-butylthian-3-amine |
| PubChem CID | 84766556 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-butylthian-3-amine |
| SMILES | CCCCC1CCSCC1N |
| InChI | InChI=1S/C9H19NS/c1-2-3-4-8-5-6-11-7-9(8)10/h8-9H,2-7,10H2,1H3 |
| InChIKey | FBJHHNKDRSDGIA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylthian-3-amine?
The IUPAC name of 4-butylthian-3-amine (CID 84766556) is 4-butylthian-3-amine.
What is the SMILES notation for 4-butylthian-3-amine?
The canonical SMILES for 4-butylthian-3-amine is CCCCC1CCSCC1N.
What is the InChIKey of 4-butylthian-3-amine?
The InChIKey is FBJHHNKDRSDGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS/c1-2-3-4-8-5-6-11-7-9(8)10/h8-9H,2-7,10H2,1H3.
What are the key properties of 4-butylthian-3-amine?
4-butylthian-3-amine has a molecular weight of 173.32 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylthian-3-amine is sourced from PubChem (CID 84766556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).