C13H14N2O4S — CID 83193161
2-[(5-oxopyrrolidine-3-carbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (PubChem CID 83193161) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[(5-oxopyrrolidine-3-carbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid.
| Compound Name | 2-[(5-oxopyrrolidine-3-carbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 83193161 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[(5-oxopyrrolidine-3-carbonyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| SMILES | O=C1CC(C(=O)Nc2sc3c(c2C(=O)O)CCC3)CN1 |
| InChI | InChI=1S/C13H14N2O4S/c16-9-4-6(5-14-9)11(17)15-12-10(13(18)19)7-2-1-3-8(7)20-12/h6H,1-5H2,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | DQQYZJSLEPBYPX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|