C12H20N2O4 — CID 83193569
2-[[(6-oxopiperidine-3-carbonyl)amino]methyl]pentanoic acid (PubChem CID 83193569) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[[(6-oxopiperidine-3-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 2-[[(6-oxopiperidine-3-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 83193569 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[[(6-oxopiperidine-3-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCCC(CNC(=O)C1CCC(=O)NC1)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-2-3-9(12(17)18)7-14-11(16)8-4-5-10(15)13-6-8/h8-9H,2-7H2,1H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | UYSSVODNKFJAQN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |