About 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one
2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one (PubChem CID 83195525) has the molecular formula C11H9FN2OS
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one |
| PubChem CID | 83195525 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one |
| SMILES | O=c1c2c([nH]n1-c1cccc(F)c1)CSC2 |
| InChI | InChI=1S/C11H9FN2OS/c12-7-2-1-3-8(4-7)14-11(15)9-5-16-6-10(9)13-14/h1-4,13H,5-6H2 |
| InChIKey | ILIWIARQRLMOAX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The IUPAC name of 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one (CID 83195525) is 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one.
What is the SMILES notation for 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The canonical SMILES for 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one is O=c1c2c([nH]n1-c1cccc(F)c1)CSC2.
What is the InChIKey of 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The InChIKey is ILIWIARQRLMOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2OS/c12-7-2-1-3-8(4-7)14-11(15)9-5-16-6-10(9)13-14/h1-4,13H,5-6H2.
What are the key properties of 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one has a molecular weight of 236.27 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one is sourced from PubChem (CID 83195525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).