C13H21NS2 — CID 83195896
N-propyl-4-(2-thiophen-2-ylethyl)thiolan-3-amine (PubChem CID 83195896) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is N-propyl-4-(2-thiophen-2-ylethyl)thiolan-3-amine.
| Compound Name | N-propyl-4-(2-thiophen-2-ylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 83195896 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-propyl-4-(2-thiophen-2-ylethyl)thiolan-3-amine |
| SMILES | CCCNC1CSCC1CCc1cccs1 |
| InChI | InChI=1S/C13H21NS2/c1-2-7-14-13-10-15-9-11(13)5-6-12-4-3-8-16-12/h3-4,8,11,13-14H,2,5-7,9-10H2,1H3 |
| InChIKey | OHQHBPVAINPPPE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |