C14H23NS — CID 81017720
N-[[2-(2-thiophen-2-ylethyl)cyclobutyl]methyl]propan-1-amine (PubChem CID 81017720) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is N-[[2-(2-thiophen-2-ylethyl)cyclobutyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2-thiophen-2-ylethyl)cyclobutyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81017720 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-[[2-(2-thiophen-2-ylethyl)cyclobutyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC1CCc1cccs1 |
| InChI | InChI=1S/C14H23NS/c1-2-9-15-11-13-6-5-12(13)7-8-14-4-3-10-16-14/h3-4,10,12-13,15H,2,5-9,11H2,1H3 |
| InChIKey | XWEBLYQGFRKWHN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|