C11H9N3O3S — CID 83196989
2-(2-nitrophenyl)-4,6-dihydro-3aH-thieno[3,4-c]pyrazol-3-one (PubChem CID 83196989) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-4,6-dihydro-3aH-thieno[3,4-c]pyrazol-3-one.
| Compound Name | 2-(2-nitrophenyl)-4,6-dihydro-3aH-thieno[3,4-c]pyrazol-3-one |
|---|---|
| PubChem CID | 83196989 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(2-nitrophenyl)-4,6-dihydro-3aH-thieno[3,4-c]pyrazol-3-one |
| SMILES | O=C1C2CSCC2=NN1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N3O3S/c15-11-7-5-18-6-8(7)12-13(11)9-3-1-2-4-10(9)14(16)17/h1-4,7H,5-6H2 |
| InChIKey | XQVOMQMHNNGBJF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|