About N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide
N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide (PubChem CID 83201783) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide |
| PubChem CID | 83201783 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC(=O)NOC1CCCC1 |
| InChI | InChI=1S/C12H22N2O3/c1-12(2,3)11(16)13-8-10(15)14-17-9-6-4-5-7-9/h9H,4-8H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | XHUPDERGRXAJQK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide (CID 83201783) is N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)NCC(=O)NOC1CCCC1.
What is the InChIKey of N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide?
The InChIKey is XHUPDERGRXAJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-12(2,3)11(16)13-8-10(15)14-17-9-6-4-5-7-9/h9H,4-8H2,1-3H3,(H,13,16)(H,14,15).
What are the key properties of N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide?
N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide has a molecular weight of 242.32 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclopentyloxyamino)-2-oxoethyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 83201783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).