C10H19N3O4 — CID 89002717
N-[2-[[2-(methoxyamino)-2-oxoethyl]amino]-2-oxoethyl]-2,2-dimethylpropanamide (PubChem CID 89002717) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[2-[[2-(methoxyamino)-2-oxoethyl]amino]-2-oxoethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[2-(methoxyamino)-2-oxoethyl]amino]-2-oxoethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 89002717 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[2-[[2-(methoxyamino)-2-oxoethyl]amino]-2-oxoethyl]-2,2-dimethylpropanamide |
| SMILES | CONC(=O)CNC(=O)CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H19N3O4/c1-10(2,3)9(16)12-5-7(14)11-6-8(15)13-17-4/h5-6H2,1-4H3,(H,11,14)(H,12,16)(H,13,15) |
| InChIKey | NCBHDGVTJYLOFL-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|