C12H23N3O3 — CID 83202418
2-(carbamoylamino)-N-cyclopentyloxy-4-methylpentanamide (PubChem CID 83202418) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-cyclopentyloxy-4-methylpentanamide.
| Compound Name | 2-(carbamoylamino)-N-cyclopentyloxy-4-methylpentanamide |
|---|---|
| PubChem CID | 83202418 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-(carbamoylamino)-N-cyclopentyloxy-4-methylpentanamide |
| SMILES | CC(C)CC(NC(N)=O)C(=O)NOC1CCCC1 |
| InChI | InChI=1S/C12H23N3O3/c1-8(2)7-10(14-12(13)17)11(16)15-18-9-5-3-4-6-9/h8-10H,3-7H2,1-2H3,(H,15,16)(H3,13,14,17) |
| InChIKey | SCZMFQGDXSCULJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|