C11H21NO2 — CID 83202498
N-cyclopentyloxy-2,3-dimethylbutanamide (PubChem CID 83202498) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-cyclopentyloxy-2,3-dimethylbutanamide.
| Compound Name | N-cyclopentyloxy-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 83202498 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-cyclopentyloxy-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)NOC1CCCC1 |
| InChI | InChI=1S/C11H21NO2/c1-8(2)9(3)11(13)12-14-10-6-4-5-7-10/h8-10H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | CMOXZPIVNXFLCQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|