C15H10Cl2FN3 — CID 83203297
3-(2,5-dichlorophenyl)-1-(2-fluorophenyl)pyrazol-4-amine (PubChem CID 83203297) has the molecular formula C15H10Cl2FN3 and a molecular weight of 322.17 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-1-(2-fluorophenyl)pyrazol-4-amine.
| Compound Name | 3-(2,5-dichlorophenyl)-1-(2-fluorophenyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 83203297 |
| Molecular Formula | C15H10Cl2FN3 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-1-(2-fluorophenyl)pyrazol-4-amine |
| SMILES | Nc1cn(-c2ccccc2F)nc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H10Cl2FN3/c16-9-5-6-11(17)10(7-9)15-13(19)8-21(20-15)14-4-2-1-3-12(14)18/h1-8H,19H2 |
| InChIKey | CMXZDURABYCGHC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |