C13H9Cl2N3S — CID 83216351
1-(2,4-dichlorophenyl)-3-thiophen-2-ylpyrazol-4-amine (PubChem CID 83216351) has the molecular formula C13H9Cl2N3S and a molecular weight of 310.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-thiophen-2-ylpyrazol-4-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-3-thiophen-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 83216351 |
| Molecular Formula | C13H9Cl2N3S |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-thiophen-2-ylpyrazol-4-amine |
| SMILES | Nc1cn(-c2ccc(Cl)cc2Cl)nc1-c1cccs1 |
| InChI | InChI=1S/C13H9Cl2N3S/c14-8-3-4-11(9(15)6-8)18-7-10(16)13(17-18)12-2-1-5-19-12/h1-7H,16H2 |
| InChIKey | UYNUFLXXPMXRFH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |