C13H7Cl3FNO3 — CID 83206717
2-amino-3-fluoro-6-(2,4,5-trichlorophenoxy)benzoic acid (PubChem CID 83206717) has the molecular formula C13H7Cl3FNO3 and a molecular weight of 350.56 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-(2,4,5-trichlorophenoxy)benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-(2,4,5-trichlorophenoxy)benzoic acid |
|---|---|
| PubChem CID | 83206717 |
| Molecular Formula | C13H7Cl3FNO3 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 2-amino-3-fluoro-6-(2,4,5-trichlorophenoxy)benzoic acid |
| SMILES | Nc1c(F)ccc(Oc2cc(Cl)c(Cl)cc2Cl)c1C(=O)O |
| InChI | InChI=1S/C13H7Cl3FNO3/c14-5-3-7(16)10(4-6(5)15)21-9-2-1-8(17)12(18)11(9)13(19)20/h1-4H,18H2,(H,19,20) |
| InChIKey | QHCXSNQYGFZNIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|