C13H8Cl2FNO3 — CID 83214912
2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid (PubChem CID 83214912) has the molecular formula C13H8Cl2FNO3 and a molecular weight of 316.12 g/mol. Its IUPAC name is 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83214912 |
| Molecular Formula | C13H8Cl2FNO3 |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid |
| SMILES | Nc1c(F)ccc(Oc2cccc(Cl)c2Cl)c1C(=O)O |
| InChI | InChI=1S/C13H8Cl2FNO3/c14-6-2-1-3-9(11(6)15)20-8-5-4-7(16)12(17)10(8)13(18)19/h1-5H,17H2,(H,18,19) |
| InChIKey | LOURMSCGNKHZOW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|