2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid

C13H8Cl2FNO3 — CID 83214912

IUPAC2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid
SMILESNc1c(F)ccc(Oc2cccc(Cl)c2Cl)c1C(=O)O
InChIInChI=1S/C13H8Cl2FNO3/c14-6-2-1-3-9(11(6)15)20-8-5-4-7(16)12(17)10(8)13(18)19/h1-5H,17H2,(H,18,19)
InChIKeyLOURMSCGNKHZOW-UHFFFAOYSA-N
MW316.12 g/mol
LogP4.21
Rot. Bonds3

About 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid

2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid (PubChem CID 83214912) has the molecular formula C13H8Cl2FNO3 and a molecular weight of 316.12 g/mol. Its IUPAC name is 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid.

Molecular Properties

Compound Name2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid
PubChem CID83214912
Molecular FormulaC13H8Cl2FNO3
Molecular Weight316.12 g/mol
Exact Mass314.99
IUPAC Name2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid
SMILESNc1c(F)ccc(Oc2cccc(Cl)c2Cl)c1C(=O)O
InChIInChI=1S/C13H8Cl2FNO3/c14-6-2-1-3-9(11(6)15)20-8-5-4-7(16)12(17)10(8)13(18)19/h1-5H,17H2,(H,18,19)
InChIKeyLOURMSCGNKHZOW-UHFFFAOYSA-N
XLogP4.21
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.12
LogP ≤ 54.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid?
The IUPAC name of 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid (CID 83214912) is 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid.
What is the SMILES notation for 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid?
The canonical SMILES for 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid is Nc1c(F)ccc(Oc2cccc(Cl)c2Cl)c1C(=O)O.
What is the InChIKey of 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid?
The InChIKey is LOURMSCGNKHZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2FNO3/c14-6-2-1-3-9(11(6)15)20-8-5-4-7(16)12(17)10(8)13(18)19/h1-5H,17H2,(H,18,19).
What are the key properties of 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid?
2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid has a molecular weight of 316.12 g/mol, XLogP of 4.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,3-dichlorophenoxy)-3-fluorobenzoic acid is sourced from PubChem (CID 83214912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).