C15H28N4O — CID 83207677
4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 83207677) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 83207677 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(NC2CCN3CCCC23)CC1 |
| InChI | InChI=1S/C15H28N4O/c1-17(2)15(20)19-9-5-12(6-10-19)16-13-7-11-18-8-3-4-14(13)18/h12-14,16H,3-11H2,1-2H3 |
| InChIKey | OKTDDOYHESJCNC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |