C15H23F3N2O — CID 83209246
N-methyl-2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine (PubChem CID 83209246) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is N-methyl-2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine.
| Compound Name | N-methyl-2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 83209246 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-methyl-2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
| SMILES | CNC1CCCCc2cn(CCCOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C15H23F3N2O/c1-19-14-6-3-2-5-12-9-20(10-13(12)14)7-4-8-21-11-15(16,17)18/h9-10,14,19H,2-8,11H2,1H3 |
| InChIKey | HGCWHRGXWRGQSV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|