C16H16FN3O — CID 83210085
6-amino-N-(4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 83210085) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 6-amino-N-(4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 6-amino-N-(4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 83210085 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-amino-N-(4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1cc2c(cc1N)N(C(=O)Nc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C16H16FN3O/c1-10-8-11-6-7-20(15(11)9-14(10)18)16(21)19-13-4-2-12(17)3-5-13/h2-5,8-9H,6-7,18H2,1H3,(H,19,21) |
| InChIKey | QDBVWISLPYTTHN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|