C11H13FN2O3 — CID 83210328
2-[(2-fluoro-4-methylbenzoyl)amino]ethyl carbamate (PubChem CID 83210328) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 2-[(2-fluoro-4-methylbenzoyl)amino]ethyl carbamate.
| Compound Name | 2-[(2-fluoro-4-methylbenzoyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83210328 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-[(2-fluoro-4-methylbenzoyl)amino]ethyl carbamate |
| SMILES | Cc1ccc(C(=O)NCCOC(N)=O)c(F)c1 |
| InChI | InChI=1S/C11H13FN2O3/c1-7-2-3-8(9(12)6-7)10(15)14-4-5-17-11(13)16/h2-3,6H,4-5H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | AMXCSGRJYRWYGD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|