C15H21N5 — CID 83212369
5-methyl-1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3-dihydroindol-6-amine (PubChem CID 83212369) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 5-methyl-1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3-dihydroindol-6-amine.
| Compound Name | 5-methyl-1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 83212369 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 5-methyl-1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3-dihydroindol-6-amine |
| SMILES | Cc1cc2c(cc1N)N(Cc1ncnn1C(C)C)CC2 |
| InChI | InChI=1S/C15H21N5/c1-10(2)20-15(17-9-18-20)8-19-5-4-12-6-11(3)13(16)7-14(12)19/h6-7,9-10H,4-5,8,16H2,1-3H3 |
| InChIKey | AYXPENUKXHAANS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|