C16H17N3O — CID 83212613
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-methyl-2-pyridinyl)methanone (PubChem CID 83212613) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-methyl-2-pyridinyl)methanone.
| Compound Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 83212613 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(3-methyl-2-pyridinyl)methanone |
| SMILES | Cc1cc2c(cc1N)N(C(=O)c1ncccc1C)CC2 |
| InChI | InChI=1S/C16H17N3O/c1-10-4-3-6-18-15(10)16(20)19-7-5-12-8-11(2)13(17)9-14(12)19/h3-4,6,8-9H,5,7,17H2,1-2H3 |
| InChIKey | LJDNOTDEKAJTEN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|